C20H23N3O5 — CID 56760922
2,4-dimethoxy-N-[(E)-[4-(3-methoxyanilino)-4-oxobutan-2-ylidene]amino]benzamide (PubChem CID 56760922) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2,4-dimethoxy-N-[(E)-[4-(3-methoxyanilino)-4-oxobutan-2-ylidene]amino]benzamide.
| Compound Name | 2,4-dimethoxy-N-[(E)-[4-(3-methoxyanilino)-4-oxobutan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 56760922 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2,4-dimethoxy-N-[(E)-[4-(3-methoxyanilino)-4-oxobutan-2-ylidene]amino]benzamide |
| SMILES | COc1cccc(NC(=O)C/C(C)=N/NC(=O)c2ccc(OC)cc2OC)c1 |
| InChI | InChI=1S/C20H23N3O5/c1-13(10-19(24)21-14-6-5-7-15(11-14)26-2)22-23-20(25)17-9-8-16(27-3)12-18(17)28-4/h5-9,11-12H,10H2,1-4H3,(H,21,24)(H,23,25)/b22-13+ |
| InChIKey | DKRJMLAYFYQIDG-LPYMAVHISA-N |
| XLogP | 2.85 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|