C19H19Cl2N3O4 — CID 6040738
N-[(Z)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide (PubChem CID 6040738) has the molecular formula C19H19Cl2N3O4 and a molecular weight of 424.28 g/mol. Its IUPAC name is N-[(Z)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide.
| Compound Name | N-[(Z)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 6040738 |
| Molecular Formula | C19H19Cl2N3O4 |
| Molecular Weight | 424.28 g/mol |
| Exact Mass | 423.08 |
| IUPAC Name | N-[(Z)-[4-(3,4-dichloroanilino)-4-oxobutan-2-ylidene]amino]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N/N=C(/C)CC(=O)Nc2ccc(Cl)c(Cl)c2)c(OC)c1 |
| InChI | InChI=1S/C19H19Cl2N3O4/c1-11(8-18(25)22-12-4-7-15(20)16(21)9-12)23-24-19(26)14-6-5-13(27-2)10-17(14)28-3/h4-7,9-10H,8H2,1-3H3,(H,22,25)(H,24,26)/b23-11- |
| InChIKey | GRJOWFNXAVVQKJ-KSEXSDGBSA-N |
| XLogP | 4.15 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|