C16H15ClN2O4 — CID 46570655
2-chloro-5-[(2,4-dimethoxybenzoyl)amino]benzamide (PubChem CID 46570655) has the molecular formula C16H15ClN2O4 and a molecular weight of 334.76 g/mol. Its IUPAC name is 2-chloro-5-[(2,4-dimethoxybenzoyl)amino]benzamide.
| Compound Name | 2-chloro-5-[(2,4-dimethoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 46570655 |
| Molecular Formula | C16H15ClN2O4 |
| Molecular Weight | 334.76 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-chloro-5-[(2,4-dimethoxybenzoyl)amino]benzamide |
| SMILES | COc1ccc(C(=O)Nc2ccc(Cl)c(C(N)=O)c2)c(OC)c1 |
| InChI | InChI=1S/C16H15ClN2O4/c1-22-10-4-5-11(14(8-10)23-2)16(21)19-9-3-6-13(17)12(7-9)15(18)20/h3-8H,1-2H3,(H2,18,20)(H,19,21) |
| InChIKey | WHSODYNCJPDURF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.76 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |