C17H16BrFO4 — CID 158719520
2-bromo-4-[2-(2,4-dimethoxyphenyl)ethyl]-5-fluorobenzoic acid (PubChem CID 158719520) has the molecular formula C17H16BrFO4 and a molecular weight of 383.21 g/mol. Its IUPAC name is 2-bromo-4-[2-(2,4-dimethoxyphenyl)ethyl]-5-fluorobenzoic acid.
| Compound Name | 2-bromo-4-[2-(2,4-dimethoxyphenyl)ethyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 158719520 |
| Molecular Formula | C17H16BrFO4 |
| Molecular Weight | 383.21 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 2-bromo-4-[2-(2,4-dimethoxyphenyl)ethyl]-5-fluorobenzoic acid |
| SMILES | COc1ccc(CCc2cc(Br)c(C(=O)O)cc2F)c(OC)c1 |
| InChI | InChI=1S/C17H16BrFO4/c1-22-12-6-5-10(16(8-12)23-2)3-4-11-7-14(18)13(17(20)21)9-15(11)19/h5-9H,3-4H2,1-2H3,(H,20,21) |
| InChIKey | IJSRYTYWUNBQHA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.21 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |