C16H14BrFO3 — CID 114968000
2-(2-bromo-4-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanone (PubChem CID 114968000) has the molecular formula C16H14BrFO3 and a molecular weight of 353.19 g/mol. Its IUPAC name is 2-(2-bromo-4-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-(2-bromo-4-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 114968000 |
| Molecular Formula | C16H14BrFO3 |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 352.01 |
| IUPAC Name | 2-(2-bromo-4-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cc2ccc(F)cc2Br)c(OC)c1 |
| InChI | InChI=1S/C16H14BrFO3/c1-20-12-5-6-13(16(9-12)21-2)15(19)7-10-3-4-11(18)8-14(10)17/h3-6,8-9H,7H2,1-2H3 |
| InChIKey | XLHSOIFGSSXDCO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |