C16H14F2O4 — CID 78790506
2-(2,4-difluorophenoxy)-1-(2,4-dimethoxyphenyl)ethanone (PubChem CID 78790506) has the molecular formula C16H14F2O4 and a molecular weight of 308.28 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-1-(2,4-dimethoxyphenyl)ethanone.
| Compound Name | 2-(2,4-difluorophenoxy)-1-(2,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 78790506 |
| Molecular Formula | C16H14F2O4 |
| Molecular Weight | 308.28 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-1-(2,4-dimethoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)COc2ccc(F)cc2F)c(OC)c1 |
| InChI | InChI=1S/C16H14F2O4/c1-20-11-4-5-12(16(8-11)21-2)14(19)9-22-15-6-3-10(17)7-13(15)18/h3-8H,9H2,1-2H3 |
| InChIKey | ZPVMEBVEUBDCNO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |