C23H19FO5 — CID 4314291
1-(2,4-dimethoxyphenyl)-2-[4-(4-fluorobenzoyl)phenoxy]ethanone (PubChem CID 4314291) has the molecular formula C23H19FO5 and a molecular weight of 394.40 g/mol. Its IUPAC name is 1-(2,4-dimethoxyphenyl)-2-[4-(4-fluorobenzoyl)phenoxy]ethanone.
| Compound Name | 1-(2,4-dimethoxyphenyl)-2-[4-(4-fluorobenzoyl)phenoxy]ethanone |
|---|---|
| PubChem CID | 4314291 |
| Molecular Formula | C23H19FO5 |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.12 |
| IUPAC Name | 1-(2,4-dimethoxyphenyl)-2-[4-(4-fluorobenzoyl)phenoxy]ethanone |
| SMILES | COc1ccc(C(=O)COc2ccc(C(=O)c3ccc(F)cc3)cc2)c(OC)c1 |
| InChI | InChI=1S/C23H19FO5/c1-27-19-11-12-20(22(13-19)28-2)21(25)14-29-18-9-5-16(6-10-18)23(26)15-3-7-17(24)8-4-15/h3-13H,14H2,1-2H3 |
| InChIKey | DIXNLCUWUFDYAD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |