[2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate

C24H20O6 — CID 8925475

IUPAC[2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate
SMILESCOc1ccccc1C(=O)COC(=O)COc1ccc(C(=O)c2ccccc2)cc1
InChIInChI=1S/C24H20O6/c1-28-22-10-6-5-9-20(22)21(25)15-30-23(26)16-29-19-13-11-18(12-14-19)24(27)17-7-3-2-4-8-17/h2-14H,15-16H2,1H3
InChIKeyCUHAEOHMZOFJNR-UHFFFAOYSA-N
MW404.42 g/mol
LogP3.73
Rot. Bonds9

About [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate

[2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate (PubChem CID 8925475) has the molecular formula C24H20O6 and a molecular weight of 404.42 g/mol. Its IUPAC name is [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate.

Molecular Properties

Compound Name[2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate
PubChem CID8925475
Molecular FormulaC24H20O6
Molecular Weight404.42 g/mol
Exact Mass404.13
IUPAC Name[2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate
SMILESCOc1ccccc1C(=O)COC(=O)COc1ccc(C(=O)c2ccccc2)cc1
InChIInChI=1S/C24H20O6/c1-28-22-10-6-5-9-20(22)21(25)15-30-23(26)16-29-19-13-11-18(12-14-19)24(27)17-7-3-2-4-8-17/h2-14H,15-16H2,1H3
InChIKeyCUHAEOHMZOFJNR-UHFFFAOYSA-N
XLogP3.73
TPSA78.90 Ų
H-Bond Donors
H-Bond Acceptors6
Rotatable Bonds9
Heavy Atoms30
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500404.42
LogP ≤ 53.73
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 106

Analyze [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate?
The IUPAC name of [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate (CID 8925475) is [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate.
What is the SMILES notation for [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate?
The canonical SMILES for [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate is COc1ccccc1C(=O)COC(=O)COc1ccc(C(=O)c2ccccc2)cc1.
What is the InChIKey of [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate?
The InChIKey is CUHAEOHMZOFJNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20O6/c1-28-22-10-6-5-9-20(22)21(25)15-30-23(26)16-29-19-13-11-18(12-14-19)24(27)17-7-3-2-4-8-17/h2-14H,15-16H2,1H3.
What are the key properties of [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate?
[2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate has a molecular weight of 404.42 g/mol, XLogP of 3.73, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2-methoxyphenyl)-2-oxoethyl] 2-(4-benzoylphenoxy)acetate is sourced from PubChem (CID 8925475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).