C16H15F2NO4 — CID 39908076
2-(2,4-difluorophenoxy)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 39908076) has the molecular formula C16H15F2NO4 and a molecular weight of 323.30 g/mol. Its IUPAC name is 2-(2,4-difluorophenoxy)-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-(2,4-difluorophenoxy)-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 39908076 |
| Molecular Formula | C16H15F2NO4 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-(2,4-difluorophenoxy)-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(OC)c(NC(=O)COc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C16H15F2NO4/c1-21-11-4-6-15(22-2)13(8-11)19-16(20)9-23-14-5-3-10(17)7-12(14)18/h3-8H,9H2,1-2H3,(H,19,20) |
| InChIKey | WKNAIVRPIMYRQR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |