C17H17F2N3O5 — CID 2206472
1-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)urea (PubChem CID 2206472) has the molecular formula C17H17F2N3O5 and a molecular weight of 381.34 g/mol. Its IUPAC name is 1-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)urea.
| Compound Name | 1-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 2206472 |
| Molecular Formula | C17H17F2N3O5 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 1-[[2-(2,4-difluorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)urea |
| SMILES | COc1ccc(OC)c(NC(=O)NNC(=O)COc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C17H17F2N3O5/c1-25-11-4-6-15(26-2)13(8-11)20-17(24)22-21-16(23)9-27-14-5-3-10(18)7-12(14)19/h3-8H,9H2,1-2H3,(H,21,23)(H2,20,22,24) |
| InChIKey | DUIRPHPDXXHAKH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|