C17H16F2N2O5 — CID 47085137
2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4,5-dimethoxybenzamide (PubChem CID 47085137) has the molecular formula C17H16F2N2O5 and a molecular weight of 366.32 g/mol. Its IUPAC name is 2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4,5-dimethoxybenzamide.
| Compound Name | 2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 47085137 |
| Molecular Formula | C17H16F2N2O5 |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 2-[[2-(2,4-difluorophenoxy)acetyl]amino]-4,5-dimethoxybenzamide |
| SMILES | COc1cc(NC(=O)COc2ccc(F)cc2F)c(C(N)=O)cc1OC |
| InChI | InChI=1S/C17H16F2N2O5/c1-24-14-6-10(17(20)23)12(7-15(14)25-2)21-16(22)8-26-13-4-3-9(18)5-11(13)19/h3-7H,8H2,1-2H3,(H2,20,23)(H,21,22) |
| InChIKey | ZLYQBLOKXLHUDS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |