C17H17Cl2N3O4S — CID 17283054
1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea (PubChem CID 17283054) has the molecular formula C17H17Cl2N3O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is 1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea.
| Compound Name | 1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea |
|---|---|
| PubChem CID | 17283054 |
| Molecular Formula | C17H17Cl2N3O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 1-[[2-(2,4-dichlorophenoxy)acetyl]amino]-3-(2,5-dimethoxyphenyl)thiourea |
| SMILES | COc1ccc(OC)c(NC(=S)NNC(=O)COc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C17H17Cl2N3O4S/c1-24-11-4-6-15(25-2)13(8-11)20-17(27)22-21-16(23)9-26-14-5-3-10(18)7-12(14)19/h3-8H,9H2,1-2H3,(H,21,23)(H2,20,22,27) |
| InChIKey | HBYLCLNQJNKEBQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 80.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|