C16H16BrFO3 — CID 65150727
2-(5-bromo-2-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanol (PubChem CID 65150727) has the molecular formula C16H16BrFO3 and a molecular weight of 355.20 g/mol. Its IUPAC name is 2-(5-bromo-2-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanol.
| Compound Name | 2-(5-bromo-2-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 65150727 |
| Molecular Formula | C16H16BrFO3 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | 2-(5-bromo-2-fluorophenyl)-1-(2,4-dimethoxyphenyl)ethanol |
| SMILES | COc1ccc(C(O)Cc2cc(Br)ccc2F)c(OC)c1 |
| InChI | InChI=1S/C16H16BrFO3/c1-20-12-4-5-13(16(9-12)21-2)15(19)8-10-7-11(17)3-6-14(10)18/h3-7,9,15,19H,8H2,1-2H3 |
| InChIKey | YBFUYQYJIPTPTC-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |