C21H39N2O3P — CID 167225872
N-[(2,4-dimethoxyphenyl)methoxy-(dipropylamino)phosphanyl]-N-propylpropan-1-amine (PubChem CID 167225872) has the molecular formula C21H39N2O3P and a molecular weight of 398.53 g/mol. Its IUPAC name is N-[(2,4-dimethoxyphenyl)methoxy-(dipropylamino)phosphanyl]-N-propylpropan-1-amine.
| Compound Name | N-[(2,4-dimethoxyphenyl)methoxy-(dipropylamino)phosphanyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 167225872 |
| Molecular Formula | C21H39N2O3P |
| Molecular Weight | 398.53 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | N-[(2,4-dimethoxyphenyl)methoxy-(dipropylamino)phosphanyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)P(OCc1ccc(OC)cc1OC)N(CCC)CCC |
| InChI | InChI=1S/C21H39N2O3P/c1-7-13-22(14-8-2)27(23(15-9-3)16-10-4)26-18-19-11-12-20(24-5)17-21(19)25-6/h11-12,17H,7-10,13-16,18H2,1-6H3 |
| InChIKey | PAXIJVNJQTZCFT-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.53 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|