C14H24O2 — CID 158953080
1-(2,2-dimethylpropyl)-2,4-dimethoxybenzene;methane (PubChem CID 158953080) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-2,4-dimethoxybenzene;methane.
| Compound Name | 1-(2,2-dimethylpropyl)-2,4-dimethoxybenzene;methane |
|---|---|
| PubChem CID | 158953080 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 1-(2,2-dimethylpropyl)-2,4-dimethoxybenzene;methane |
| SMILES | C.COc1ccc(CC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C13H20O2.CH4/c1-13(2,3)9-10-6-7-11(14-4)8-12(10)15-5;/h6-8H,9H2,1-5H3;1H4 |
| InChIKey | JLRDENOPLURHSY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |