C13H15NO4 — CID 82131291
2-cyano-3-(2,4-dimethoxyphenyl)-2-methylpropanoic acid (PubChem CID 82131291) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 2-cyano-3-(2,4-dimethoxyphenyl)-2-methylpropanoic acid.
| Compound Name | 2-cyano-3-(2,4-dimethoxyphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 82131291 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 2-cyano-3-(2,4-dimethoxyphenyl)-2-methylpropanoic acid |
| SMILES | COc1ccc(CC(C)(C#N)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C13H15NO4/c1-13(8-14,12(15)16)7-9-4-5-10(17-2)6-11(9)18-3/h4-6H,7H2,1-3H3,(H,15,16) |
| InChIKey | RZVOPWSJQILMNC-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 79.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |