C11H15BNO5 — CID 171771046
CID 171771046 (PubChem CID 171771046) has the molecular formula C11H15BNO5 and a molecular weight of 252.06 g/mol.
| Compound Name | CID 171771046 |
|---|---|
| PubChem CID | 171771046 |
| Molecular Formula | C11H15BNO5 |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | — |
| SMILES | COc1cc(O[B]O)ccc1C[C@](C)(N)C(=O)O |
| InChI | InChI=1S/C11H15BNO5/c1-11(13,10(14)15)6-7-3-4-8(18-12-16)5-9(7)17-2/h3-5,16H,6,13H2,1-2H3,(H,14,15)/t11-/m0/s1 |
| InChIKey | MSCLVZDECFPGPU-NSHDSACASA-N |
| XLogP | -0.05 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|