About CID 171771019
CID 171771019 (PubChem CID 171771019) has the molecular formula C11H13BF2NO4
and a molecular weight of 272.04 g/mol.
Molecular Properties
| Compound Name | CID 171771019 |
| PubChem CID | 171771019 |
| Molecular Formula | C11H13BF2NO4 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | — |
| SMILES | C[C@@](N)(Cc1ccc(O[B]O)cc1C(F)F)C(=O)O |
| InChI | InChI=1S/C11H13BF2NO4/c1-11(15,10(16)17)5-6-2-3-7(19-12-18)4-8(6)9(13)14/h2-4,9,18H,5,15H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | GEVRYPNBFOSYHS-LLVKDONJSA-N |
| XLogP | 0.87 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 171771019 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 171771019?
The IUPAC name of CID 171771019 (CID 171771019) is not available.
What is the SMILES notation for CID 171771019?
The canonical SMILES for CID 171771019 is C[C@@](N)(Cc1ccc(O[B]O)cc1C(F)F)C(=O)O.
What is the InChIKey of CID 171771019?
The InChIKey is GEVRYPNBFOSYHS-LLVKDONJSA-N. The full InChI is InChI=1S/C11H13BF2NO4/c1-11(15,10(16)17)5-6-2-3-7(19-12-18)4-8(6)9(13)14/h2-4,9,18H,5,15H2,1H3,(H,16,17)/t11-/m1/s1.
What are the key properties of CID 171771019?
CID 171771019 has a molecular weight of 272.04 g/mol, XLogP of 0.87, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 171771019 is sourced from PubChem (CID 171771019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).