C11H13BF2NO4 — CID 171771019
CID 171771019 (PubChem CID 171771019) has the molecular formula C11H13BF2NO4 and a molecular weight of 272.04 g/mol.
| Compound Name | CID 171771019 |
|---|---|
| PubChem CID | 171771019 |
| Molecular Formula | C11H13BF2NO4 |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | — |
| SMILES | C[C@@](N)(Cc1ccc(O[B]O)cc1C(F)F)C(=O)O |
| InChI | InChI=1S/C11H13BF2NO4/c1-11(15,10(16)17)5-6-2-3-7(19-12-18)4-8(6)9(13)14/h2-4,9,18H,5,15H2,1H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | GEVRYPNBFOSYHS-LLVKDONJSA-N |
| XLogP | 0.87 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|