C10H13BFNO4 — CID 175991442
2-amino-3-(4-borono-2-fluorophenyl)-2-methylpropanoic acid (PubChem CID 175991442) has the molecular formula C10H13BFNO4 and a molecular weight of 241.03 g/mol. Its IUPAC name is 2-amino-3-(4-borono-2-fluorophenyl)-2-methylpropanoic acid.
| Compound Name | 2-amino-3-(4-borono-2-fluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175991442 |
| Molecular Formula | C10H13BFNO4 |
| Molecular Weight | 241.03 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-amino-3-(4-borono-2-fluorophenyl)-2-methylpropanoic acid |
| SMILES | CC(N)(Cc1ccc(B(O)O)cc1F)C(=O)O |
| InChI | InChI=1S/C10H13BFNO4/c1-10(13,9(14)15)5-6-2-3-7(11(16)17)4-8(6)12/h2-4,16-17H,5,13H2,1H3,(H,14,15) |
| InChIKey | OKCZGLMQBJFNMB-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.03 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|