C10H12BF2NO4 — CID 166544620
(2S)-2-amino-3-(4-borono-2,6-difluorophenyl)-2-methylpropanoic acid (PubChem CID 166544620) has the molecular formula C10H12BF2NO4 and a molecular weight of 259.02 g/mol. Its IUPAC name is (2S)-2-amino-3-(4-borono-2,6-difluorophenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(4-borono-2,6-difluorophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166544620 |
| Molecular Formula | C10H12BF2NO4 |
| Molecular Weight | 259.02 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | (2S)-2-amino-3-(4-borono-2,6-difluorophenyl)-2-methylpropanoic acid |
| SMILES | C[C@](N)(Cc1c(F)cc(B(O)O)cc1F)C(=O)O |
| InChI | InChI=1S/C10H12BF2NO4/c1-10(14,9(15)16)4-6-7(12)2-5(11(17)18)3-8(6)13/h2-3,17-18H,4,14H2,1H3,(H,15,16)/t10-/m0/s1 |
| InChIKey | YGYXUPYUYLCOFA-JTQLQIEISA-N |
| XLogP | -1.01 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.02 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|