C10H15BN2O4 — CID 166544653
(2S)-2-amino-3-(2-amino-4-boronophenyl)-2-methylpropanoic acid (PubChem CID 166544653) has the molecular formula C10H15BN2O4 and a molecular weight of 238.05 g/mol. Its IUPAC name is (2S)-2-amino-3-(2-amino-4-boronophenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(2-amino-4-boronophenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 166544653 |
| Molecular Formula | C10H15BN2O4 |
| Molecular Weight | 238.05 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | (2S)-2-amino-3-(2-amino-4-boronophenyl)-2-methylpropanoic acid |
| SMILES | C[C@](N)(Cc1ccc(B(O)O)cc1N)C(=O)O |
| InChI | InChI=1S/C10H15BN2O4/c1-10(13,9(14)15)5-6-2-3-7(11(16)17)4-8(6)12/h2-4,16-17H,5,12-13H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | NJOXVOJOQARYFO-JTQLQIEISA-N |
| XLogP | -1.71 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.05 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|