C13H21BFNO2 — CID 54970430
[3-fluoro-4-[[methyl(pentyl)amino]methyl]phenyl]boronic acid (PubChem CID 54970430) has the molecular formula C13H21BFNO2 and a molecular weight of 253.13 g/mol. Its IUPAC name is [3-fluoro-4-[[methyl(pentyl)amino]methyl]phenyl]boronic acid.
| Compound Name | [3-fluoro-4-[[methyl(pentyl)amino]methyl]phenyl]boronic acid |
|---|---|
| PubChem CID | 54970430 |
| Molecular Formula | C13H21BFNO2 |
| Molecular Weight | 253.13 g/mol |
| Exact Mass | 253.16 |
| IUPAC Name | [3-fluoro-4-[[methyl(pentyl)amino]methyl]phenyl]boronic acid |
| SMILES | CCCCCN(C)Cc1ccc(B(O)O)cc1F |
| InChI | InChI=1S/C13H21BFNO2/c1-3-4-5-8-16(2)10-11-6-7-12(14(17)18)9-13(11)15/h6-7,9,17-18H,3-5,8,10H2,1-2H3 |
| InChIKey | PAJHQWBHEMSYSP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|