C15H25FN2 — CID 107454220
N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-N-methylpentan-1-amine (PubChem CID 107454220) has the molecular formula C15H25FN2 and a molecular weight of 252.38 g/mol. Its IUPAC name is N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-N-methylpentan-1-amine.
| Compound Name | N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-N-methylpentan-1-amine |
|---|---|
| PubChem CID | 107454220 |
| Molecular Formula | C15H25FN2 |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-N-methylpentan-1-amine |
| SMILES | CCCCCN(C)Cc1cc(CNC)ccc1F |
| InChI | InChI=1S/C15H25FN2/c1-4-5-6-9-18(3)12-14-10-13(11-17-2)7-8-15(14)16/h7-8,10,17H,4-6,9,11-12H2,1-3H3 |
| InChIKey | YNQOZFBNNFNUJV-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|