C15H25FN2O2 — CID 107454826
N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine (PubChem CID 107454826) has the molecular formula C15H25FN2O2 and a molecular weight of 284.38 g/mol. Its IUPAC name is N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine.
| Compound Name | N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine |
|---|---|
| PubChem CID | 107454826 |
| Molecular Formula | C15H25FN2O2 |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | N-[[2-fluoro-5-(methylaminomethyl)phenyl]methyl]-2-methoxy-N-(2-methoxyethyl)ethanamine |
| SMILES | CNCc1ccc(F)c(CN(CCOC)CCOC)c1 |
| InChI | InChI=1S/C15H25FN2O2/c1-17-11-13-4-5-15(16)14(10-13)12-18(6-8-19-2)7-9-20-3/h4-5,10,17H,6-9,11-12H2,1-3H3 |
| InChIKey | GUEXYVNHTBQTKV-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |