C15H23BrN2O — CID 103340393
N-[[2-bromo-4-(methylaminomethyl)phenyl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine (PubChem CID 103340393) has the molecular formula C15H23BrN2O and a molecular weight of 327.27 g/mol. Its IUPAC name is N-[[2-bromo-4-(methylaminomethyl)phenyl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine.
| Compound Name | N-[[2-bromo-4-(methylaminomethyl)phenyl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103340393 |
| Molecular Formula | C15H23BrN2O |
| Molecular Weight | 327.27 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-[[2-bromo-4-(methylaminomethyl)phenyl]methyl]-N-(2-methoxyethyl)prop-2-en-1-amine |
| SMILES | C=CCN(CCOC)Cc1ccc(CNC)cc1Br |
| InChI | InChI=1S/C15H23BrN2O/c1-4-7-18(8-9-19-3)12-14-6-5-13(11-17-2)10-15(14)16/h4-6,10,17H,1,7-9,11-12H2,2-3H3 |
| InChIKey | ZIYIJOCEYAJMJB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.27 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|