C12H16BrClFNO — CID 114859388
N-(2-bromoethyl)-N-[(4-chloro-2-fluorophenyl)methyl]-2-methoxyethanamine (PubChem CID 114859388) has the molecular formula C12H16BrClFNO and a molecular weight of 324.62 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(4-chloro-2-fluorophenyl)methyl]-2-methoxyethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(4-chloro-2-fluorophenyl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 114859388 |
| Molecular Formula | C12H16BrClFNO |
| Molecular Weight | 324.62 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | N-(2-bromoethyl)-N-[(4-chloro-2-fluorophenyl)methyl]-2-methoxyethanamine |
| SMILES | COCCN(CCBr)Cc1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H16BrClFNO/c1-17-7-6-16(5-4-13)9-10-2-3-11(14)8-12(10)15/h2-3,8H,4-7,9H2,1H3 |
| InChIKey | MFNUMZUTRCNHPB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.62 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|