C12H19BFNO3 — CID 54970679
[4-[[ethyl(2-methoxyethyl)amino]methyl]-3-fluorophenyl]boronic acid (PubChem CID 54970679) has the molecular formula C12H19BFNO3 and a molecular weight of 255.10 g/mol. Its IUPAC name is [4-[[ethyl(2-methoxyethyl)amino]methyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[ethyl(2-methoxyethyl)amino]methyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 54970679 |
| Molecular Formula | C12H19BFNO3 |
| Molecular Weight | 255.10 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | [4-[[ethyl(2-methoxyethyl)amino]methyl]-3-fluorophenyl]boronic acid |
| SMILES | CCN(CCOC)Cc1ccc(B(O)O)cc1F |
| InChI | InChI=1S/C12H19BFNO3/c1-3-15(6-7-18-2)9-10-4-5-11(13(16)17)8-12(10)14/h4-5,8,16-17H,3,6-7,9H2,1-2H3 |
| InChIKey | YWIPAXWLWKRCDV-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.10 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|