C12H19BFNO2 — CID 54970862
[4-[[ethyl(propyl)amino]methyl]-3-fluorophenyl]boronic acid (PubChem CID 54970862) has the molecular formula C12H19BFNO2 and a molecular weight of 239.10 g/mol. Its IUPAC name is [4-[[ethyl(propyl)amino]methyl]-3-fluorophenyl]boronic acid.
| Compound Name | [4-[[ethyl(propyl)amino]methyl]-3-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 54970862 |
| Molecular Formula | C12H19BFNO2 |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | [4-[[ethyl(propyl)amino]methyl]-3-fluorophenyl]boronic acid |
| SMILES | CCCN(CC)Cc1ccc(B(O)O)cc1F |
| InChI | InChI=1S/C12H19BFNO2/c1-3-7-15(4-2)9-10-5-6-11(13(16)17)8-12(10)14/h5-6,8,16-17H,3-4,7,9H2,1-2H3 |
| InChIKey | OLINSWMQEKYQIV-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|