C10H13BN2O3 — CID 175991443
(2S)-2-amino-3-(3-amino-4-oxoboranylphenyl)-2-methylpropanoic acid (PubChem CID 175991443) has the molecular formula C10H13BN2O3 and a molecular weight of 220.04 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-amino-4-oxoboranylphenyl)-2-methylpropanoic acid.
| Compound Name | (2S)-2-amino-3-(3-amino-4-oxoboranylphenyl)-2-methylpropanoic acid |
|---|---|
| PubChem CID | 175991443 |
| Molecular Formula | C10H13BN2O3 |
| Molecular Weight | 220.04 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | (2S)-2-amino-3-(3-amino-4-oxoboranylphenyl)-2-methylpropanoic acid |
| SMILES | C[C@](N)(Cc1ccc(B=O)c(N)c1)C(=O)O |
| InChI | InChI=1S/C10H13BN2O3/c1-10(13,9(14)15)5-6-2-3-7(11-16)8(12)4-6/h2-4H,5,12-13H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | YVILHNPUHQHUEB-JTQLQIEISA-N |
| XLogP | -0.71 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.04 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|