C12H15FINO3 — CID 90345479
2-amino-3-[5-(2-fluoroethoxy)-2-iodophenyl]-2-methylpropanoic acid (PubChem CID 90345479) has the molecular formula C12H15FINO3 and a molecular weight of 367.16 g/mol. Its IUPAC name is 2-amino-3-[5-(2-fluoroethoxy)-2-iodophenyl]-2-methylpropanoic acid.
| Compound Name | 2-amino-3-[5-(2-fluoroethoxy)-2-iodophenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 90345479 |
| Molecular Formula | C12H15FINO3 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | 2-amino-3-[5-(2-fluoroethoxy)-2-iodophenyl]-2-methylpropanoic acid |
| SMILES | CC(N)(Cc1cc(OCCF)ccc1I)C(=O)O |
| InChI | InChI=1S/C12H15FINO3/c1-12(15,11(16)17)7-8-6-9(18-5-4-13)2-3-10(8)14/h2-3,6H,4-5,7,15H2,1H3,(H,16,17) |
| InChIKey | JXHJZMHHXNUBBV-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|