C13H18FNO3S — CID 90345521
2-amino-3-[5-(2-fluoroethoxy)-2-methylsulfanylphenyl]-2-methylpropanoic acid (PubChem CID 90345521) has the molecular formula C13H18FNO3S and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-amino-3-[5-(2-fluoroethoxy)-2-methylsulfanylphenyl]-2-methylpropanoic acid.
| Compound Name | 2-amino-3-[5-(2-fluoroethoxy)-2-methylsulfanylphenyl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 90345521 |
| Molecular Formula | C13H18FNO3S |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-amino-3-[5-(2-fluoroethoxy)-2-methylsulfanylphenyl]-2-methylpropanoic acid |
| SMILES | CSc1ccc(OCCF)cc1CC(C)(N)C(=O)O |
| InChI | InChI=1S/C13H18FNO3S/c1-13(15,12(16)17)8-9-7-10(18-6-5-14)3-4-11(9)19-2/h3-4,7H,5-6,8,15H2,1-2H3,(H,16,17) |
| InChIKey | AKKDCUHTSUHBOE-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |