C12H15F2NO3 — CID 90345475
2-amino-3-[5-(2-fluoroethoxy)-2-(fluoromethyl)phenyl]propanoic acid (PubChem CID 90345475) has the molecular formula C12H15F2NO3 and a molecular weight of 259.25 g/mol. Its IUPAC name is 2-amino-3-[5-(2-fluoroethoxy)-2-(fluoromethyl)phenyl]propanoic acid.
| Compound Name | 2-amino-3-[5-(2-fluoroethoxy)-2-(fluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 90345475 |
| Molecular Formula | C12H15F2NO3 |
| Molecular Weight | 259.25 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-amino-3-[5-(2-fluoroethoxy)-2-(fluoromethyl)phenyl]propanoic acid |
| SMILES | NC(Cc1cc(OCCF)ccc1CF)C(=O)O |
| InChI | InChI=1S/C12H15F2NO3/c13-3-4-18-10-2-1-8(7-14)9(5-10)6-11(15)12(16)17/h1-2,5,11H,3-4,6-7,15H2,(H,16,17) |
| InChIKey | IBYRHVOHHJGQKG-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.25 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |