C17H20O5 — CID 91244154
4-[(2,4-dimethoxyphenyl)methyl]-2,6-dimethoxyphenol (PubChem CID 91244154) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is 4-[(2,4-dimethoxyphenyl)methyl]-2,6-dimethoxyphenol.
| Compound Name | 4-[(2,4-dimethoxyphenyl)methyl]-2,6-dimethoxyphenol |
|---|---|
| PubChem CID | 91244154 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 4-[(2,4-dimethoxyphenyl)methyl]-2,6-dimethoxyphenol |
| SMILES | COc1ccc(Cc2cc(OC)c(O)c(OC)c2)c(OC)c1 |
| InChI | InChI=1S/C17H20O5/c1-19-13-6-5-12(14(10-13)20-2)7-11-8-15(21-3)17(18)16(9-11)22-4/h5-6,8-10,18H,7H2,1-4H3 |
| InChIKey | IMNNFEXGOYMMJR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |