C10H16ClN3O2 — CID 155435073
2-[(2,4-dimethoxyphenyl)methyl]guanidine;hydrochloride (PubChem CID 155435073) has the molecular formula C10H16ClN3O2 and a molecular weight of 245.71 g/mol. Its IUPAC name is 2-[(2,4-dimethoxyphenyl)methyl]guanidine;hydrochloride.
| Compound Name | 2-[(2,4-dimethoxyphenyl)methyl]guanidine;hydrochloride |
|---|---|
| PubChem CID | 155435073 |
| Molecular Formula | C10H16ClN3O2 |
| Molecular Weight | 245.71 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | 2-[(2,4-dimethoxyphenyl)methyl]guanidine;hydrochloride |
| SMILES | COc1ccc(CN=C(N)N)c(OC)c1.Cl |
| InChI | InChI=1S/C10H15N3O2.ClH/c1-14-8-4-3-7(6-13-10(11)12)9(5-8)15-2;/h3-5H,6H2,1-2H3,(H4,11,12,13);1H |
| InChIKey | JUJNMCJOCJTOHR-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.71 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|