C9H11N3O2 — CID 14217595
1-(azidomethyl)-2,4-dimethoxybenzene (PubChem CID 14217595) has the molecular formula C9H11N3O2 and a molecular weight of 193.21 g/mol. Its IUPAC name is 1-(azidomethyl)-2,4-dimethoxybenzene.
| Compound Name | 1-(azidomethyl)-2,4-dimethoxybenzene |
|---|---|
| PubChem CID | 14217595 |
| Molecular Formula | C9H11N3O2 |
| Molecular Weight | 193.21 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | 1-(azidomethyl)-2,4-dimethoxybenzene |
| SMILES | COc1ccc(CN=[N+]=[N-])c(OC)c1 |
| InChI | InChI=1S/C9H11N3O2/c1-13-8-4-3-7(6-11-12-10)9(5-8)14-2/h3-5H,6H2,1-2H3 |
| InChIKey | AOFXCKAODUKBJW-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.21 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|