C12H17N3O4 — CID 171879758
4-azido-1-(2,4-dimethoxyphenyl)butane-1,2-diol (PubChem CID 171879758) has the molecular formula C12H17N3O4 and a molecular weight of 267.29 g/mol. Its IUPAC name is 4-azido-1-(2,4-dimethoxyphenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(2,4-dimethoxyphenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879758 |
| Molecular Formula | C12H17N3O4 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.12 |
| IUPAC Name | 4-azido-1-(2,4-dimethoxyphenyl)butane-1,2-diol |
| SMILES | COc1ccc(C(O)C(O)CCN=[N+]=[N-])c(OC)c1 |
| InChI | InChI=1S/C12H17N3O4/c1-18-8-3-4-9(11(7-8)19-2)12(17)10(16)5-6-14-15-13/h3-4,7,10,12,16-17H,5-6H2,1-2H3 |
| InChIKey | QJTBRMZFMPJVFB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|