C11H15N5O5 — CID 171880368
1-(2-amino-5-methoxy-3-nitrophenyl)-4-azidobutane-1,2-diol (PubChem CID 171880368) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 1-(2-amino-5-methoxy-3-nitrophenyl)-4-azidobutane-1,2-diol.
| Compound Name | 1-(2-amino-5-methoxy-3-nitrophenyl)-4-azidobutane-1,2-diol |
|---|---|
| PubChem CID | 171880368 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-(2-amino-5-methoxy-3-nitrophenyl)-4-azidobutane-1,2-diol |
| SMILES | COc1cc(C(O)C(O)CCN=[N+]=[N-])c(N)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H15N5O5/c1-21-6-4-7(10(12)8(5-6)16(19)20)11(18)9(17)2-3-14-15-13/h4-5,9,11,17-18H,2-3,12H2,1H3 |
| InChIKey | VQCKNICNSOGVGU-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 167.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|