C11H11N5O5 — CID 171880630
3-(4-azido-1,2-dihydroxybutyl)-4-hydroxy-5-nitrobenzonitrile (PubChem CID 171880630) has the molecular formula C11H11N5O5 and a molecular weight of 293.24 g/mol. Its IUPAC name is 3-(4-azido-1,2-dihydroxybutyl)-4-hydroxy-5-nitrobenzonitrile.
| Compound Name | 3-(4-azido-1,2-dihydroxybutyl)-4-hydroxy-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 171880630 |
| Molecular Formula | C11H11N5O5 |
| Molecular Weight | 293.24 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-(4-azido-1,2-dihydroxybutyl)-4-hydroxy-5-nitrobenzonitrile |
| SMILES | N#Cc1cc(C(O)C(O)CCN=[N+]=[N-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H11N5O5/c12-5-6-3-7(10(18)8(4-6)16(20)21)11(19)9(17)1-2-14-15-13/h3-4,9,11,17-19H,1-2H2 |
| InChIKey | CPLNQFQCMYNVNW-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 176.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.24 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|