C11H14N4O6S — CID 171880422
4-azido-1-(4-methylsulfonyl-2-nitrophenyl)butane-1,2-diol (PubChem CID 171880422) has the molecular formula C11H14N4O6S and a molecular weight of 330.32 g/mol. Its IUPAC name is 4-azido-1-(4-methylsulfonyl-2-nitrophenyl)butane-1,2-diol.
| Compound Name | 4-azido-1-(4-methylsulfonyl-2-nitrophenyl)butane-1,2-diol |
|---|---|
| PubChem CID | 171880422 |
| Molecular Formula | C11H14N4O6S |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.06 |
| IUPAC Name | 4-azido-1-(4-methylsulfonyl-2-nitrophenyl)butane-1,2-diol |
| SMILES | CS(=O)(=O)c1ccc(C(O)C(O)CCN=[N+]=[N-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C11H14N4O6S/c1-22(20,21)7-2-3-8(9(6-7)15(18)19)11(17)10(16)4-5-13-14-12/h2-3,6,10-11,16-17H,4-5H2,1H3 |
| InChIKey | ZOCQRPNYDBZFPH-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 166.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|