C10H9NO8S — CID 75488559
2-(4-methylsulfonyl-2-nitrophenyl)propanedioic acid (PubChem CID 75488559) has the molecular formula C10H9NO8S and a molecular weight of 303.25 g/mol. Its IUPAC name is 2-(4-methylsulfonyl-2-nitrophenyl)propanedioic acid.
| Compound Name | 2-(4-methylsulfonyl-2-nitrophenyl)propanedioic acid |
|---|---|
| PubChem CID | 75488559 |
| Molecular Formula | C10H9NO8S |
| Molecular Weight | 303.25 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | 2-(4-methylsulfonyl-2-nitrophenyl)propanedioic acid |
| SMILES | CS(=O)(=O)c1ccc(C(C(=O)O)C(=O)O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C10H9NO8S/c1-20(18,19)5-2-3-6(7(4-5)11(16)17)8(9(12)13)10(14)15/h2-4,8H,1H3,(H,12,13)(H,14,15) |
| InChIKey | POVXPGPAWCAGJE-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 151.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.25 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|