C10H10NNaO9S2 — CID 59735504
sodium 1-hydroxy-2-(4-methylsulfonyl-2-nitrophenyl)-3-oxopropane-1-sulfonate (PubChem CID 59735504) has the molecular formula C10H10NNaO9S2 and a molecular weight of 375.31 g/mol. Its IUPAC name is sodium 1-hydroxy-2-(4-methylsulfonyl-2-nitrophenyl)-3-oxopropane-1-sulfonate.
| Compound Name | sodium 1-hydroxy-2-(4-methylsulfonyl-2-nitrophenyl)-3-oxopropane-1-sulfonate |
|---|---|
| PubChem CID | 59735504 |
| Molecular Formula | C10H10NNaO9S2 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.97 |
| IUPAC Name | sodium 1-hydroxy-2-(4-methylsulfonyl-2-nitrophenyl)-3-oxopropane-1-sulfonate |
| SMILES | CS(=O)(=O)c1ccc(C(C=O)C(O)S(=O)(=O)[O-])c([N+](=O)[O-])c1.[Na+] |
| InChI | InChI=1S/C10H11NO9S2.Na/c1-21(16,17)6-2-3-7(9(4-6)11(14)15)8(5-12)10(13)22(18,19)20;/h2-5,8,10,13H,1H3,(H,18,19,20);/q;+1/p-1 |
| InChIKey | POVALZNWVOABDL-UHFFFAOYSA-M |
| XLogP | -3.85 |
| TPSA | 171.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|