C11H12N4O5 — CID 171880176
4-(4-azido-1,2-dihydroxybutyl)-3-nitrobenzaldehyde (PubChem CID 171880176) has the molecular formula C11H12N4O5 and a molecular weight of 280.24 g/mol. Its IUPAC name is 4-(4-azido-1,2-dihydroxybutyl)-3-nitrobenzaldehyde.
| Compound Name | 4-(4-azido-1,2-dihydroxybutyl)-3-nitrobenzaldehyde |
|---|---|
| PubChem CID | 171880176 |
| Molecular Formula | C11H12N4O5 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.08 |
| IUPAC Name | 4-(4-azido-1,2-dihydroxybutyl)-3-nitrobenzaldehyde |
| SMILES | [N-]=[N+]=NCCC(O)C(O)c1ccc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H12N4O5/c12-14-13-4-3-10(17)11(18)8-2-1-7(6-16)5-9(8)15(19)20/h1-2,5-6,10-11,17-18H,3-4H2 |
| InChIKey | ZYOQQFWEPGSNLZ-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 149.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|