C10H10N2O6 — CID 171868874
3-(4-formyl-2-nitrophenyl)-2,3-dihydroxypropanamide (PubChem CID 171868874) has the molecular formula C10H10N2O6 and a molecular weight of 254.20 g/mol. Its IUPAC name is 3-(4-formyl-2-nitrophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(4-formyl-2-nitrophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868874 |
| Molecular Formula | C10H10N2O6 |
| Molecular Weight | 254.20 g/mol |
| Exact Mass | 254.05 |
| IUPAC Name | 3-(4-formyl-2-nitrophenyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc(C=O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H10N2O6/c11-10(16)9(15)8(14)6-2-1-5(4-13)3-7(6)12(17)18/h1-4,8-9,14-15H,(H2,11,16) |
| InChIKey | CTAMUFATXITADP-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.20 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|