C9H9FN2O6 — CID 171868869
3-(5-fluoro-2-hydroxy-3-nitrophenyl)-2,3-dihydroxypropanamide (PubChem CID 171868869) has the molecular formula C9H9FN2O6 and a molecular weight of 260.18 g/mol. Its IUPAC name is 3-(5-fluoro-2-hydroxy-3-nitrophenyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(5-fluoro-2-hydroxy-3-nitrophenyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171868869 |
| Molecular Formula | C9H9FN2O6 |
| Molecular Weight | 260.18 g/mol |
| Exact Mass | 260.04 |
| IUPAC Name | 3-(5-fluoro-2-hydroxy-3-nitrophenyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1cc(F)cc([N+](=O)[O-])c1O |
| InChI | InChI=1S/C9H9FN2O6/c10-3-1-4(7(14)8(15)9(11)16)6(13)5(2-3)12(17)18/h1-2,7-8,13-15H,(H2,11,16) |
| InChIKey | YHLWUZRAQULIKE-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 146.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.18 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|