C11H12FNO6 — CID 171864724
methyl 3-(5-fluoro-2-methyl-3-nitrophenyl)-2,3-dihydroxypropanoate (PubChem CID 171864724) has the molecular formula C11H12FNO6 and a molecular weight of 273.22 g/mol. Its IUPAC name is methyl 3-(5-fluoro-2-methyl-3-nitrophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(5-fluoro-2-methyl-3-nitrophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 171864724 |
| Molecular Formula | C11H12FNO6 |
| Molecular Weight | 273.22 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | methyl 3-(5-fluoro-2-methyl-3-nitrophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1cc(F)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C11H12FNO6/c1-5-7(9(14)10(15)11(16)19-2)3-6(12)4-8(5)13(17)18/h3-4,9-10,14-15H,1-2H3 |
| InChIKey | LDDJVTFICODGSU-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.22 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|