C15H21NO5 — CID 90380267
methyl 2-(2,5-dimethyl-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 90380267) has the molecular formula C15H21NO5 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-(2,5-dimethyl-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | methyl 2-(2,5-dimethyl-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 90380267 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | methyl 2-(2,5-dimethyl-3-nitrophenyl)-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | COC(=O)C(OC(C)(C)C)c1cc(C)cc([N+](=O)[O-])c1C |
| InChI | InChI=1S/C15H21NO5/c1-9-7-11(10(2)12(8-9)16(18)19)13(14(17)20-6)21-15(3,4)5/h7-8,13H,1-6H3 |
| InChIKey | CIUGDXCZJAOUCX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|