C9H10N2O4 — CID 171867942
3-(4-formyl-2-pyridinyl)-2,3-dihydroxypropanamide (PubChem CID 171867942) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 3-(4-formyl-2-pyridinyl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(4-formyl-2-pyridinyl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171867942 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-(4-formyl-2-pyridinyl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1cc(C=O)ccn1 |
| InChI | InChI=1S/C9H10N2O4/c10-9(15)8(14)7(13)6-3-5(4-12)1-2-11-6/h1-4,7-8,13-14H,(H2,10,15) |
| InChIKey | SBCFNRNBPRQFBC-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 113.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|