C8H10N2O3 — CID 171867575
2,3-dihydroxy-3-pyridin-2-ylpropanamide (PubChem CID 171867575) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 2,3-dihydroxy-3-pyridin-2-ylpropanamide.
| Compound Name | 2,3-dihydroxy-3-pyridin-2-ylpropanamide |
|---|---|
| PubChem CID | 171867575 |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.07 |
| IUPAC Name | 2,3-dihydroxy-3-pyridin-2-ylpropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccccn1 |
| InChI | InChI=1S/C8H10N2O3/c9-8(13)7(12)6(11)5-3-1-2-4-10-5/h1-4,6-7,11-12H,(H2,9,13) |
| InChIKey | IRHZMFSLNPJNQA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 96.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |