C9H12N2O4 — CID 171867949
2,3-dihydroxy-3-(6-methoxy-2-pyridinyl)propanamide (PubChem CID 171867949) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(6-methoxy-2-pyridinyl)propanamide.
| Compound Name | 2,3-dihydroxy-3-(6-methoxy-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 171867949 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2,3-dihydroxy-3-(6-methoxy-2-pyridinyl)propanamide |
| SMILES | COc1cccc(C(O)C(O)C(N)=O)n1 |
| InChI | InChI=1S/C9H12N2O4/c1-15-6-4-2-3-5(11-6)7(12)8(13)9(10)14/h2-4,7-8,12-13H,1H3,(H2,10,14) |
| InChIKey | ZHLWBPQOMFBHTM-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |