C9H12INO2 — CID 137495708
(1S,2S)-1-iodo-1-(6-methoxy-2-pyridinyl)propan-2-ol (PubChem CID 137495708) has the molecular formula C9H12INO2 and a molecular weight of 293.10 g/mol. Its IUPAC name is (1S,2S)-1-iodo-1-(6-methoxy-2-pyridinyl)propan-2-ol.
| Compound Name | (1S,2S)-1-iodo-1-(6-methoxy-2-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 137495708 |
| Molecular Formula | C9H12INO2 |
| Molecular Weight | 293.10 g/mol |
| Exact Mass | 292.99 |
| IUPAC Name | (1S,2S)-1-iodo-1-(6-methoxy-2-pyridinyl)propan-2-ol |
| SMILES | COc1cccc([C@H](I)[C@H](C)O)n1 |
| InChI | InChI=1S/C9H12INO2/c1-6(12)9(10)7-4-3-5-8(11-7)13-2/h3-6,9,12H,1-2H3/t6-,9+/m0/s1 |
| InChIKey | NPNLPGGXJRKYOO-IMTBSYHQSA-N |
| XLogP | 1.95 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.10 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|